About CID 45271968
CID 45271968 (PubChem CID 45271968) has the molecular formula C21H19N3O3S
and a molecular weight of 393.47 g/mol.
Molecular Properties
| Compound Name | CID 45271968 |
| PubChem CID | 45271968 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc([C@H]2CN(C)[C@@]3(C(=O)Nc4ccccc43)[C@@]23SC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-12-7-9-13(10-8-12)15-11-24(2)20(21(15)18(26)23-19(27)28-21)14-5-3-4-6-16(14)22-17(20)25/h3-10,15H,11H2,1-2H3,(H,22,25)(H,23,26,27)/t15-,20+,21-/m1/s1 |
| InChIKey | BKOKPKAUYWOJRE-GQWLDOHISA-N |
| XLogP | 2.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 45271968 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 45271968?
The IUPAC name of CID 45271968 (CID 45271968) is not available.
What is the SMILES notation for CID 45271968?
The canonical SMILES for CID 45271968 is Cc1ccc([C@H]2CN(C)[C@@]3(C(=O)Nc4ccccc43)[C@@]23SC(=O)NC3=O)cc1.
What is the InChIKey of CID 45271968?
The InChIKey is BKOKPKAUYWOJRE-GQWLDOHISA-N. The full InChI is InChI=1S/C21H19N3O3S/c1-12-7-9-13(10-8-12)15-11-24(2)20(21(15)18(26)23-19(27)28-21)14-5-3-4-6-16(14)22-17(20)25/h3-10,15H,11H2,1-2H3,(H,22,25)(H,23,26,27)/t15-,20+,21-/m1/s1.
What are the key properties of CID 45271968?
CID 45271968 has a molecular weight of 393.47 g/mol, XLogP of 2.59, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 45271968 is sourced from PubChem (CID 45271968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).