C27H26N4O4 — CID 45272042
3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethyl-6-pyridin-2-ylbenzamide (PubChem CID 45272042) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethyl-6-pyridin-2-ylbenzamide.
| Compound Name | 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethyl-6-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 45272042 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 3-[[3,4-dioxo-2-[[(1R)-1-phenylpropyl]amino]cyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethyl-6-pyridin-2-ylbenzamide |
| SMILES | CC[C@@H](Nc1c(Nc2ccc(-c3ccccn3)c(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C27H26N4O4/c1-4-18(16-10-6-5-7-11-16)29-22-23(26(34)25(22)33)30-20-14-13-17(19-12-8-9-15-28-19)21(24(20)32)27(35)31(2)3/h5-15,18,29-30,32H,4H2,1-3H3/t18-/m1/s1 |
| InChIKey | QDJIUOZZAONOQM-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|