C17H23N3O — CID 45272045
3-(pyrrolidin-1-ylmethyl)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one (PubChem CID 45272045) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(pyrrolidin-1-ylmethyl)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one.
| Compound Name | 3-(pyrrolidin-1-ylmethyl)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
|---|---|
| PubChem CID | 45272045 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 3-(pyrrolidin-1-ylmethyl)-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxalin-6-one |
| SMILES | O=C1Nc2cc(CN3CCCC3)ccc2N2CCCCC12 |
| InChI | InChI=1S/C17H23N3O/c21-17-16-5-1-2-10-20(16)15-7-6-13(11-14(15)18-17)12-19-8-3-4-9-19/h6-7,11,16H,1-5,8-10,12H2,(H,18,21) |
| InChIKey | CFSCMJAXYYFBFU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|