C23H19F2N3O4 — CID 45272097
5-(3,5-difluorophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 45272097) has the molecular formula C23H19F2N3O4 and a molecular weight of 439.42 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 5-(3,5-difluorophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 45272097 |
| Molecular Formula | C23H19F2N3O4 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 5-(3,5-difluorophenyl)-8-(furan-2-yl)-1,3-dimethyl-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1cc(F)cc(F)c1)C1=C(CC(c3ccco3)CC1=O)N2 |
| InChI | InChI=1S/C23H19F2N3O4/c1-27-21-20(22(30)28(2)23(27)31)18(12-6-13(24)10-14(25)7-12)19-15(26-21)8-11(9-16(19)29)17-4-3-5-32-17/h3-7,10-11,18,26H,8-9H2,1-2H3 |
| InChIKey | NCKMJQCOKVJNKJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |