About N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide
N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide (PubChem CID 45272366) has the molecular formula C21H33N3O3
and a molecular weight of 375.51 g/mol. Its IUPAC name is N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide.
Molecular Properties
| Compound Name | N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide |
| PubChem CID | 45272366 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide |
| SMILES | CC(C)(CC(=O)NC1CC1)CC(=O)NC1C2CC3CC1CC(C(N)=O)(C3)C2 |
| InChI | InChI=1S/C21H33N3O3/c1-20(2,10-16(25)23-15-3-4-15)11-17(26)24-18-13-5-12-6-14(18)9-21(7-12,8-13)19(22)27/h12-15,18H,3-11H2,1-2H3,(H2,22,27)(H,23,25)(H,24,26) |
| InChIKey | VLDUQTLOJSSOIR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
The IUPAC name of N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide (CID 45272366) is N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide.
What is the SMILES notation for N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
The canonical SMILES for N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide is CC(C)(CC(=O)NC1CC1)CC(=O)NC1C2CC3CC1CC(C(N)=O)(C3)C2.
What is the InChIKey of N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
The InChIKey is VLDUQTLOJSSOIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33N3O3/c1-20(2,10-16(25)23-15-3-4-15)11-17(26)24-18-13-5-12-6-14(18)9-21(7-12,8-13)19(22)27/h12-15,18H,3-11H2,1-2H3,(H2,22,27)(H,23,25)(H,24,26).
What are the key properties of N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide?
N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide has a molecular weight of 375.51 g/mol, XLogP of 1.87, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-carbamoyl-2-adamantyl)-N'-cyclopropyl-3,3-dimethylpentanediamide is sourced from PubChem (CID 45272366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).