C13H13N3O — CID 45272442
6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-2-carbonitrile (PubChem CID 45272442) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-2-carbonitrile.
| Compound Name | 6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-2-carbonitrile |
|---|---|
| PubChem CID | 45272442 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)N1CCCCC1C(=O)N2 |
| InChI | InChI=1S/C13H13N3O/c14-8-9-4-5-10-12(7-9)16-6-2-1-3-11(16)13(17)15-10/h4-5,7,11H,1-3,6H2,(H,15,17) |
| InChIKey | ZPVHXKODTCBGCF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |