About 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole
4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole (PubChem CID 45272508) has the molecular formula C13H8N4O3S
and a molecular weight of 300.30 g/mol. Its IUPAC name is 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole |
| PubChem CID | 45272508 |
| Molecular Formula | C13H8N4O3S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole |
| SMILES | O=S(=O)(c1cccc2nonc12)n1ccc2ncccc21 |
| InChI | InChI=1S/C13H8N4O3S/c18-21(19,12-5-1-3-10-13(12)16-20-15-10)17-8-6-9-11(17)4-2-7-14-9/h1-8H |
| InChIKey | JUBPPAOPMAHYNT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole?
The IUPAC name of 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole (CID 45272508) is 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole.
What is the SMILES notation for 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole?
The canonical SMILES for 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole is O=S(=O)(c1cccc2nonc12)n1ccc2ncccc21.
What is the InChIKey of 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole?
The InChIKey is JUBPPAOPMAHYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O3S/c18-21(19,12-5-1-3-10-13(12)16-20-15-10)17-8-6-9-11(17)4-2-7-14-9/h1-8H.
What are the key properties of 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole?
4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole has a molecular weight of 300.30 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolo[3,2-b]pyridin-1-ylsulfonyl-2,1,3-benzoxadiazole is sourced from PubChem (CID 45272508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).