C18H21N5O — CID 45272633
1-[2-[(1-methylpyrazol-4-yl)methylamino]ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one (PubChem CID 45272633) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[2-[(1-methylpyrazol-4-yl)methylamino]ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one.
| Compound Name | 1-[2-[(1-methylpyrazol-4-yl)methylamino]ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one |
|---|---|
| PubChem CID | 45272633 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-[2-[(1-methylpyrazol-4-yl)methylamino]ethyl]-3,7,8,9-tetrahydropyrrolo[3,2-f]isoquinolin-6-one |
| SMILES | Cn1cc(CNCCc2c[nH]c3ccc4c(c23)CCNC4=O)cn1 |
| InChI | InChI=1S/C18H21N5O/c1-23-11-12(9-22-23)8-19-6-4-13-10-21-16-3-2-15-14(17(13)16)5-7-20-18(15)24/h2-3,9-11,19,21H,4-8H2,1H3,(H,20,24) |
| InChIKey | OIODSGGCOMSLCE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|