C22H19N3OS — CID 45272713
(15R)-15-methyl-5-(2-methylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 45272713) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is (15R)-15-methyl-5-(2-methylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-15-methyl-5-(2-methylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 45272713 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (15R)-15-methyl-5-(2-methylphenyl)-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | Cc1ccccc1-c1ccc2c(ccc3sc4c(c32)NC[C@@H](C)NC4=O)n1 |
| InChI | InChI=1S/C22H19N3OS/c1-12-5-3-4-6-14(12)16-8-7-15-17(25-16)9-10-18-19(15)20-21(27-18)22(26)24-13(2)11-23-20/h3-10,13,23H,11H2,1-2H3,(H,24,26)/t13-/m1/s1 |
| InChIKey | LFNXZWVZXRCIBL-CYBMUJFWSA-N |
| XLogP | 4.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |