C28H52N2O4 — CID 45272786
2-cyclohexyl-N-[(4S,5R,6R,7S)-7-[(2-cyclohexylacetyl)amino]-5,6-dihydroxy-2,9-dimethyldecan-4-yl]acetamide (PubChem CID 45272786) has the molecular formula C28H52N2O4 and a molecular weight of 480.73 g/mol. Its IUPAC name is 2-cyclohexyl-N-[(4S,5R,6R,7S)-7-[(2-cyclohexylacetyl)amino]-5,6-dihydroxy-2,9-dimethyldecan-4-yl]acetamide.
| Compound Name | 2-cyclohexyl-N-[(4S,5R,6R,7S)-7-[(2-cyclohexylacetyl)amino]-5,6-dihydroxy-2,9-dimethyldecan-4-yl]acetamide |
|---|---|
| PubChem CID | 45272786 |
| Molecular Formula | C28H52N2O4 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | 2-cyclohexyl-N-[(4S,5R,6R,7S)-7-[(2-cyclohexylacetyl)amino]-5,6-dihydroxy-2,9-dimethyldecan-4-yl]acetamide |
| SMILES | CC(C)C[C@H](NC(=O)CC1CCCCC1)[C@@H](O)[C@H](O)[C@H](CC(C)C)NC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C28H52N2O4/c1-19(2)15-23(29-25(31)17-21-11-7-5-8-12-21)27(33)28(34)24(16-20(3)4)30-26(32)18-22-13-9-6-10-14-22/h19-24,27-28,33-34H,5-18H2,1-4H3,(H,29,31)(H,30,32)/t23-,24-,27+,28+/m0/s1 |
| InChIKey | IBRXADXIBGLHBF-KBJUPQRZSA-N |
| XLogP | 4.71 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |