C25H32O4S — CID 45272820
2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoic acid (PubChem CID 45272820) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoic acid.
| Compound Name | 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 45272820 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoic acid |
| SMILES | CCCCC(Sc1ccc(OCCCOc2cccc3c2CCCC3)cc1)C(=O)O |
| InChI | InChI=1S/C25H32O4S/c1-2-3-12-24(25(26)27)30-21-15-13-20(14-16-21)28-17-7-18-29-23-11-6-9-19-8-4-5-10-22(19)23/h6,9,11,13-16,24H,2-5,7-8,10,12,17-18H2,1H3,(H,26,27) |
| InChIKey | LUTLDXKHISCIJB-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|