C22H30O11 — CID 45273185
(E)-1-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-4-phenylbut-3-en-2-one (PubChem CID 45273185) has the molecular formula C22H30O11 and a molecular weight of 470.47 g/mol. Its IUPAC name is (E)-1-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-4-phenylbut-3-en-2-one.
| Compound Name | (E)-1-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 45273185 |
| Molecular Formula | C22H30O11 |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (E)-1-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-4-phenylbut-3-en-2-one |
| SMILES | O=C(/C=C/c1ccccc1)C[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H30O11/c23-9-14-17(27)18(28)20(30)22(32-14)33-21-15(10-24)31-13(16(26)19(21)29)8-12(25)7-6-11-4-2-1-3-5-11/h1-7,13-24,26-30H,8-10H2/b7-6+/t13-,14+,15+,16-,17+,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | BLAPMHQCGJOUOM-WGLPGVLQSA-N |
| XLogP | -2.67 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|