C16H14FN5 — CID 45273193
11-(2-fluorophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine (PubChem CID 45273193) has the molecular formula C16H14FN5 and a molecular weight of 295.32 g/mol. Its IUPAC name is 11-(2-fluorophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine.
| Compound Name | 11-(2-fluorophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
|---|---|
| PubChem CID | 45273193 |
| Molecular Formula | C16H14FN5 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 11-(2-fluorophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
| SMILES | CNc1nc2[nH]c(-c3ccccc3F)cc2c2c1ncn2C |
| InChI | InChI=1S/C16H14FN5/c1-18-16-13-14(22(2)8-19-13)10-7-12(20-15(10)21-16)9-5-3-4-6-11(9)17/h3-8H,1-2H3,(H2,18,20,21) |
| InChIKey | CLRVYWUBJBJDOI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |