C12H14N2O6S — CID 45273313
(5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-pyridin-4-yl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol (PubChem CID 45273313) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is (5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-pyridin-4-yl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol.
| Compound Name | (5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-pyridin-4-yl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol |
|---|---|
| PubChem CID | 45273313 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (5R,6R,7S,8S,9R)-9-(hydroxymethyl)-3-pyridin-4-yl-1,10-dioxa-4-thia-2-azaspiro[4.5]dec-2-ene-6,7,8-triol |
| SMILES | OC[C@H]1O[C@@]2(ON=C(c3ccncc3)S2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14N2O6S/c15-5-7-8(16)9(17)10(18)12(19-7)20-14-11(21-12)6-1-3-13-4-2-6/h1-4,7-10,15-18H,5H2/t7-,8-,9+,10-,12-/m1/s1 |
| InChIKey | HLUXCJKYUBPJHJ-WSOSLHDDSA-N |
| XLogP | -1.37 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |