C17H18O4 — CID 45273316
3-(4-ethylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetraoxane (PubChem CID 45273316) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetraoxane.
| Compound Name | 3-(4-ethylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetraoxane |
|---|---|
| PubChem CID | 45273316 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-(4-ethylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetraoxane |
| SMILES | CCc1ccc(C2OOC(c3cccc(C)c3)OO2)cc1 |
| InChI | InChI=1S/C17H18O4/c1-3-13-7-9-14(10-8-13)16-18-20-17(21-19-16)15-6-4-5-12(2)11-15/h4-11,16-17H,3H2,1-2H3 |
| InChIKey | CHUNWIVYYNFJGE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|