About 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one
1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one (PubChem CID 45273334) has the molecular formula C22H27N3O
and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one |
| PubChem CID | 45273334 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one |
| SMILES | CC(C)c1cccc(N2CCN(CCN3Cc4ccccc4C3)C2=O)c1 |
| InChI | InChI=1S/C22H27N3O/c1-17(2)18-8-5-9-21(14-18)25-13-12-24(22(25)26)11-10-23-15-19-6-3-4-7-20(19)16-23/h3-9,14,17H,10-13,15-16H2,1-2H3 |
| InChIKey | CABPVRYEFMWZCX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one?
The IUPAC name of 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one (CID 45273334) is 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one.
What is the SMILES notation for 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one?
The canonical SMILES for 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one is CC(C)c1cccc(N2CCN(CCN3Cc4ccccc4C3)C2=O)c1.
What is the InChIKey of 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one?
The InChIKey is CABPVRYEFMWZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N3O/c1-17(2)18-8-5-9-21(14-18)25-13-12-24(22(25)26)11-10-23-15-19-6-3-4-7-20(19)16-23/h3-9,14,17H,10-13,15-16H2,1-2H3.
What are the key properties of 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one?
1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one has a molecular weight of 349.48 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-(3-propan-2-ylphenyl)imidazolidin-2-one is sourced from PubChem (CID 45273334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).