C34H37NO3 — CID 45273374
(1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(2-phenylethynyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 45273374) has the molecular formula C34H37NO3 and a molecular weight of 507.67 g/mol. Its IUPAC name is (1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(2-phenylethynyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(2-phenylethynyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 45273374 |
| Molecular Formula | C34H37NO3 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (1S,2S,5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(2-phenylethynyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | CN(C)c1ccc([C@H]2OC[C@@]3(C)[C@@H](CC[C@@]3(O)C#Cc3ccccc3)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C34H37NO3/c1-33-22-38-32(24-9-12-26(13-10-24)35(2)3)31-28-16-14-27(36)21-25(28)11-15-29(31)30(33)18-20-34(33,37)19-17-23-7-5-4-6-8-23/h4-10,12-13,21,29-30,32,37H,11,14-16,18,20,22H2,1-3H3/t29-,30-,32+,33-,34-/m0/s1 |
| InChIKey | ZUOVTFWGFULART-ONEWSNCBSA-N |
| XLogP | 6.02 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|