C11H17N3OS — CID 45273409
(3R,6S,7aS)-6-amino-6-[(2S)-butan-2-yl]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile (PubChem CID 45273409) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is (3R,6S,7aS)-6-amino-6-[(2S)-butan-2-yl]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile.
| Compound Name | (3R,6S,7aS)-6-amino-6-[(2S)-butan-2-yl]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
|---|---|
| PubChem CID | 45273409 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (3R,6S,7aS)-6-amino-6-[(2S)-butan-2-yl]-5-oxo-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
| SMILES | CC[C@H](C)[C@@]1(N)C[C@@H]2SC[C@@H](C#N)N2C1=O |
| InChI | InChI=1S/C11H17N3OS/c1-3-7(2)11(13)4-9-14(10(11)15)8(5-12)6-16-9/h7-9H,3-4,6,13H2,1-2H3/t7-,8+,9-,11-/m0/s1 |
| InChIKey | SVTPKDSKXXOAAJ-DKIAZLNASA-N |
| XLogP | 0.93 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |