C29H46O4 — CID 45273440
(1S,2S,4S,5R,8R,9R,10S,13S,14R,17R,18R)-9-(hydroxymethyl)-5,9,13,20,20-pentamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-ene-2,10-diol (PubChem CID 45273440) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is (1S,2S,4S,5R,8R,9R,10S,13S,14R,17R,18R)-9-(hydroxymethyl)-5,9,13,20,20-pentamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-ene-2,10-diol.
| Compound Name | (1S,2S,4S,5R,8R,9R,10S,13S,14R,17R,18R)-9-(hydroxymethyl)-5,9,13,20,20-pentamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-ene-2,10-diol |
|---|---|
| PubChem CID | 45273440 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (1S,2S,4S,5R,8R,9R,10S,13S,14R,17R,18R)-9-(hydroxymethyl)-5,9,13,20,20-pentamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-ene-2,10-diol |
| SMILES | CC1(C)CC[C@]23CO[C@@]4(C=C[C@@H]5[C@@]6(C)CC[C@H](O)[C@@](C)(CO)[C@@H]6CC[C@@]5(C)[C@@H]4C[C@@H]2O)[C@@H]3C1 |
| InChI | InChI=1S/C29H46O4/c1-24(2)12-13-28-17-33-29(21(28)15-24)11-7-18-25(3)10-8-22(31)27(5,16-30)19(25)6-9-26(18,4)20(29)14-23(28)32/h7,11,18-23,30-32H,6,8-10,12-17H2,1-5H3/t18-,19-,20+,21-,22+,23+,25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | BJSMUQGQPSXQSW-BWQQITLZSA-N |
| XLogP | 4.71 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|