C24H24N6O2 — CID 45273457
3-[1-[3-(dimethylamino)propyl]pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 45273457) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-[1-[3-(dimethylamino)propyl]pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-[3-(dimethylamino)propyl]pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 45273457 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-[1-[3-(dimethylamino)propyl]pyrazolo[5,4-b]pyridin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | CN(C)CCCn1nc(C2=C(c3cn(C)c4ccccc34)C(=O)NC2=O)c2cccnc21 |
| InChI | InChI=1S/C24H24N6O2/c1-28(2)12-7-13-30-22-16(9-6-11-25-22)21(27-30)20-19(23(31)26-24(20)32)17-14-29(3)18-10-5-4-8-15(17)18/h4-6,8-11,14H,7,12-13H2,1-3H3,(H,26,31,32) |
| InChIKey | ADSAVRZRSHDKDT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|