C21H22F3N5O — CID 45273573
6-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methylamino]pyridine-3-carbonitrile (PubChem CID 45273573) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 6-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 45273573 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 6-[[(2S)-1-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]pyrrolidin-2-yl]methylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC[C@@H]2CCCN2C(=O)C[C@H](N)Cc2cc(F)c(F)cc2F)nc1 |
| InChI | InChI=1S/C21H22F3N5O/c22-17-9-19(24)18(23)7-14(17)6-15(26)8-21(30)29-5-1-2-16(29)12-28-20-4-3-13(10-25)11-27-20/h3-4,7,9,11,15-16H,1-2,5-6,8,12,26H2,(H,27,28)/t15-,16+/m1/s1 |
| InChIKey | BUNAAXHJTQLZBX-CVEARBPZSA-N |
| XLogP | 2.73 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|