About 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide
5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide (PubChem CID 45273806) has the molecular formula C20H14F3N3O2S
and a molecular weight of 417.41 g/mol. Its IUPAC name is 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide |
| PubChem CID | 45273806 |
| Molecular Formula | C20H14F3N3O2S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide |
| SMILES | NC(=O)c1sc(-c2cnc3ccccn23)cc1OCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H14F3N3O2S/c21-20(22,23)13-6-2-1-5-12(13)11-28-15-9-16(29-18(15)19(24)27)14-10-25-17-7-3-4-8-26(14)17/h1-10H,11H2,(H2,24,27) |
| InChIKey | PXZAVZVJLWBDCB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide?
The IUPAC name of 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide (CID 45273806) is 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide.
What is the SMILES notation for 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide?
The canonical SMILES for 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide is NC(=O)c1sc(-c2cnc3ccccn23)cc1OCc1ccccc1C(F)(F)F.
What is the InChIKey of 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide?
The InChIKey is PXZAVZVJLWBDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N3O2S/c21-20(22,23)13-6-2-1-5-12(13)11-28-15-9-16(29-18(15)19(24)27)14-10-25-17-7-3-4-8-26(14)17/h1-10H,11H2,(H2,24,27).
What are the key properties of 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide?
5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide has a molecular weight of 417.41 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-imidazo[1,2-a]pyridin-3-yl-3-[[2-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxamide is sourced from PubChem (CID 45273806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).