C29H36N4O7 — CID 45273811
(4S)-4-[(4-butoxy-6-phenylpyridine-2-carbonyl)amino]-5-oxo-5-(4-prop-2-enoxycarbonylpiperazin-1-yl)pentanoic acid (PubChem CID 45273811) has the molecular formula C29H36N4O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is (4S)-4-[(4-butoxy-6-phenylpyridine-2-carbonyl)amino]-5-oxo-5-(4-prop-2-enoxycarbonylpiperazin-1-yl)pentanoic acid.
| Compound Name | (4S)-4-[(4-butoxy-6-phenylpyridine-2-carbonyl)amino]-5-oxo-5-(4-prop-2-enoxycarbonylpiperazin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 45273811 |
| Molecular Formula | C29H36N4O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (4S)-4-[(4-butoxy-6-phenylpyridine-2-carbonyl)amino]-5-oxo-5-(4-prop-2-enoxycarbonylpiperazin-1-yl)pentanoic acid |
| SMILES | C=CCOC(=O)N1CCN(C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(OCCCC)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C29H36N4O7/c1-3-5-18-39-22-19-24(21-9-7-6-8-10-21)30-25(20-22)27(36)31-23(11-12-26(34)35)28(37)32-13-15-33(16-14-32)29(38)40-17-4-2/h4,6-10,19-20,23H,2-3,5,11-18H2,1H3,(H,31,36)(H,34,35)/t23-/m0/s1 |
| InChIKey | PZXINSAKKCOUDA-QHCPKHFHSA-N |
| XLogP | 3.36 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|