C48H52O10Si — CID 45273866
[4-[[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxan-2-yl]oxymethyl]phenyl]methyl benzoate (PubChem CID 45273866) has the molecular formula C48H52O10Si and a molecular weight of 817.02 g/mol. Its IUPAC name is [4-[[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxan-2-yl]oxymethyl]phenyl]methyl benzoate.
| Compound Name | [4-[[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxan-2-yl]oxymethyl]phenyl]methyl benzoate |
|---|---|
| PubChem CID | 45273866 |
| Molecular Formula | C48H52O10Si |
| Molecular Weight | 817.02 g/mol |
| Exact Mass | 816.33 |
| IUPAC Name | [4-[[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxyoxan-2-yl]oxymethyl]phenyl]methyl benzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCc2ccc(COC(=O)c3ccccc3)cc2)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H52O10Si/c1-34(49)56-44-43(52-30-36-18-10-6-11-19-36)42(33-55-59(48(3,4)5,40-22-14-8-15-23-40)41-24-16-9-17-25-41)58-47(45(44)57-35(2)50)54-32-38-28-26-37(27-29-38)31-53-46(51)39-20-12-7-13-21-39/h6-29,42-45,47H,30-33H2,1-5H3/t42-,43-,44+,45-,47-/m1/s1 |
| InChIKey | CYZKQXIYRYMLIW-NBYWFKMKSA-N |
| XLogP | 7.31 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.02 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|