C22H16N4O5 — CID 45273990
(5S)-5-furo[3,2-b]pyridin-2-yl-5-[(7-methyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 45273990) has the molecular formula C22H16N4O5 and a molecular weight of 416.39 g/mol. Its IUPAC name is (5S)-5-furo[3,2-b]pyridin-2-yl-5-[(7-methyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-furo[3,2-b]pyridin-2-yl-5-[(7-methyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45273990 |
| Molecular Formula | C22H16N4O5 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (5S)-5-furo[3,2-b]pyridin-2-yl-5-[(7-methyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc2c3c(ccc2o1)CN(C[C@@]1(c2cc4ncccc4o2)NC(=O)NC1=O)C3=O |
| InChI | InChI=1S/C22H16N4O5/c1-11-7-13-15(30-11)5-4-12-9-26(19(27)18(12)13)10-22(20(28)24-21(29)25-22)17-8-14-16(31-17)3-2-6-23-14/h2-8H,9-10H2,1H3,(H2,24,25,28,29)/t22-/m0/s1 |
| InChIKey | AEHLWDHCWVYUOF-QFIPXVFZSA-N |
| XLogP | 2.57 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|