C28H20N4O5 — CID 45273992
(5S)-5-[(7-benzyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]-5-furo[3,2-b]pyridin-2-ylimidazolidine-2,4-dione (PubChem CID 45273992) has the molecular formula C28H20N4O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is (5S)-5-[(7-benzyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]-5-furo[3,2-b]pyridin-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(7-benzyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]-5-furo[3,2-b]pyridin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 45273992 |
| Molecular Formula | C28H20N4O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | (5S)-5-[(7-benzyl-1-oxo-3H-furo[3,2-e]isoindol-2-yl)methyl]-5-furo[3,2-b]pyridin-2-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](CN2Cc3ccc4oc(Cc5ccccc5)cc4c3C2=O)(c2cc3ncccc3o2)N1 |
| InChI | InChI=1S/C28H20N4O5/c33-25-24-17(8-9-21-19(24)12-18(36-21)11-16-5-2-1-3-6-16)14-32(25)15-28(26(34)30-27(35)31-28)23-13-20-22(37-23)7-4-10-29-20/h1-10,12-13H,11,14-15H2,(H2,30,31,34,35)/t28-/m0/s1 |
| InChIKey | NXOGXHYOWCYMMY-NDEPHWFRSA-N |
| XLogP | 3.86 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|