About 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine
6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45274228) has the molecular formula C17H14N4S2
and a molecular weight of 338.46 g/mol. Its IUPAC name is 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 45274228 |
| Molecular Formula | C17H14N4S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(-c2nc(N)c3cc(Cc4ccccc4)sc3n2)cs1 |
| InChI | InChI=1S/C17H14N4S2/c1-10-19-14(9-22-10)16-20-15(18)13-8-12(23-17(13)21-16)7-11-5-3-2-4-6-11/h2-6,8-9H,7H2,1H3,(H2,18,20,21) |
| InChIKey | APRCSRZMJCGPNC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine (CID 45274228) is 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine is Cc1nc(-c2nc(N)c3cc(Cc4ccccc4)sc3n2)cs1.
What is the InChIKey of 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is APRCSRZMJCGPNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4S2/c1-10-19-14(9-22-10)16-20-15(18)13-8-12(23-17(13)21-16)7-11-5-3-2-4-6-11/h2-6,8-9H,7H2,1H3,(H2,18,20,21).
What are the key properties of 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine?
6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 338.46 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-2-(2-methyl-1,3-thiazol-4-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 45274228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).