1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid

C11H12Cl2N2O2 — CID 45274383

IUPAC1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid
SMILESO=C(O)C1CCN(c2c(Cl)cncc2Cl)CC1
InChIInChI=1S/C11H12Cl2N2O2/c12-8-5-14-6-9(13)10(8)15-3-1-7(2-4-15)11(16)17/h5-7H,1-4H2,(H,16,17)
InChIKeyJHHDAGQONNNPQB-UHFFFAOYSA-N
MW275.13 g/mol
LogP2.69
Rot. Bonds2

About 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid

1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid (PubChem CID 45274383) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid.

Molecular Properties

Compound Name1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid
PubChem CID45274383
Molecular FormulaC11H12Cl2N2O2
Molecular Weight275.13 g/mol
Exact Mass274.03
IUPAC Name1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid
SMILESO=C(O)C1CCN(c2c(Cl)cncc2Cl)CC1
InChIInChI=1S/C11H12Cl2N2O2/c12-8-5-14-6-9(13)10(8)15-3-1-7(2-4-15)11(16)17/h5-7H,1-4H2,(H,16,17)
InChIKeyJHHDAGQONNNPQB-UHFFFAOYSA-N
XLogP2.69
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.13
LogP ≤ 52.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid?
The IUPAC name of 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid (CID 45274383) is 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid?
The canonical SMILES for 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid is O=C(O)C1CCN(c2c(Cl)cncc2Cl)CC1.
What is the InChIKey of 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid?
The InChIKey is JHHDAGQONNNPQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N2O2/c12-8-5-14-6-9(13)10(8)15-3-1-7(2-4-15)11(16)17/h5-7H,1-4H2,(H,16,17).
What are the key properties of 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid?
1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid has a molecular weight of 275.13 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxylic acid is sourced from PubChem (CID 45274383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).