About 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine
2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45274516) has the molecular formula C14H10N6OS
and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 45274516 |
| Molecular Formula | C14H10N6OS |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ncco2)nc2sc(Cc3cnccn3)cc12 |
| InChI | InChI=1S/C14H10N6OS/c15-11-10-6-9(5-8-7-16-1-2-17-8)22-14(10)20-12(19-11)13-18-3-4-21-13/h1-4,6-7H,5H2,(H2,15,19,20) |
| InChIKey | FHIWFORAIBACJF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (CID 45274516) is 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine is Nc1nc(-c2ncco2)nc2sc(Cc3cnccn3)cc12.
What is the InChIKey of 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is FHIWFORAIBACJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N6OS/c15-11-10-6-9(5-8-7-16-1-2-17-8)22-14(10)20-12(19-11)13-18-3-4-21-13/h1-4,6-7H,5H2,(H2,15,19,20).
What are the key properties of 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine?
2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 310.34 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazol-2-yl)-6-(pyrazin-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 45274516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).