C22H18N8O4 — CID 45274590
5,6,8-triamino-2-[4-(5,6,8-triamino-4-oxo-3,1-benzoxazin-2-yl)phenyl]-3,1-benzoxazin-4-one (PubChem CID 45274590) has the molecular formula C22H18N8O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is 5,6,8-triamino-2-[4-(5,6,8-triamino-4-oxo-3,1-benzoxazin-2-yl)phenyl]-3,1-benzoxazin-4-one.
| Compound Name | 5,6,8-triamino-2-[4-(5,6,8-triamino-4-oxo-3,1-benzoxazin-2-yl)phenyl]-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 45274590 |
| Molecular Formula | C22H18N8O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 5,6,8-triamino-2-[4-(5,6,8-triamino-4-oxo-3,1-benzoxazin-2-yl)phenyl]-3,1-benzoxazin-4-one |
| SMILES | Nc1cc(N)c2nc(-c3ccc(-c4nc5c(N)cc(N)c(N)c5c(=O)o4)cc3)oc(=O)c2c1N |
| InChI | InChI=1S/C22H18N8O4/c23-9-5-11(25)17-13(15(9)27)21(31)33-19(29-17)7-1-2-8(4-3-7)20-30-18-12(26)6-10(24)16(28)14(18)22(32)34-20/h1-6H,23-28H2 |
| InChIKey | UYBVQCOFFKTRSU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 242.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|