C18H19Cl4N5O — CID 45274908
1-(3,5-dichloro-4-pyridinyl)-N-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]piperidine-4-carboxamide (PubChem CID 45274908) has the molecular formula C18H19Cl4N5O and a molecular weight of 463.20 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)-N-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dichloro-4-pyridinyl)-N-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45274908 |
| Molecular Formula | C18H19Cl4N5O |
| Molecular Weight | 463.20 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | 1-(3,5-dichloro-4-pyridinyl)-N-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCNc1c(Cl)cncc1Cl)C1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C18H19Cl4N5O/c19-12-7-23-8-13(20)16(12)25-3-4-26-18(28)11-1-5-27(6-2-11)17-14(21)9-24-10-15(17)22/h7-11H,1-6H2,(H,23,25)(H,26,28) |
| InChIKey | YRXUXPPGGMJPET-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|