About N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide
N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide (PubChem CID 45275021) has the molecular formula C13H18Cl2N4O
and a molecular weight of 317.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide |
| PubChem CID | 45275021 |
| Molecular Formula | C13H18Cl2N4O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide |
| SMILES | NCCNC(=O)C1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C13H18Cl2N4O/c14-10-7-17-8-11(15)12(10)19-5-1-9(2-6-19)13(20)18-4-3-16/h7-9H,1-6,16H2,(H,18,20) |
| InChIKey | WVWKUZCOVSSGRN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide?
The IUPAC name of N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide (CID 45275021) is N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide.
What is the SMILES notation for N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide?
The canonical SMILES for N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide is NCCNC(=O)C1CCN(c2c(Cl)cncc2Cl)CC1.
What is the InChIKey of N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide?
The InChIKey is WVWKUZCOVSSGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N4O/c14-10-7-17-8-11(15)12(10)19-5-1-9(2-6-19)13(20)18-4-3-16/h7-9H,1-6,16H2,(H,18,20).
What are the key properties of N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide?
N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide has a molecular weight of 317.22 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide is sourced from PubChem (CID 45275021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).