C25H38O2 — CID 45275306
propyl (4E,7E,10E,13E,16E,18E)-docosa-4,7,10,13,16,18-hexaenoate (PubChem CID 45275306) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is propyl (4E,7E,10E,13E,16E,18E)-docosa-4,7,10,13,16,18-hexaenoate.
| Compound Name | propyl (4E,7E,10E,13E,16E,18E)-docosa-4,7,10,13,16,18-hexaenoate |
|---|---|
| PubChem CID | 45275306 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | propyl (4E,7E,10E,13E,16E,18E)-docosa-4,7,10,13,16,18-hexaenoate |
| SMILES | CCC/C=C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)OCCC |
| InChI | InChI=1S/C25H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(26)27-24-4-2/h6-9,11-12,14-15,17-18,20-21H,3-5,10,13,16,19,22-24H2,1-2H3/b7-6+,9-8+,12-11+,15-14+,18-17+,21-20+ |
| InChIKey | HVZCFTLLYWXLSF-YBROYEHISA-N |
| XLogP | 7.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|