C11H11Cl2N3 — CID 45275464
1-(3,5-dichloro-4-pyridinyl)piperidine-4-carbonitrile (PubChem CID 45275464) has the molecular formula C11H11Cl2N3 and a molecular weight of 256.14 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carbonitrile.
| Compound Name | 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 45275464 |
| Molecular Formula | C11H11Cl2N3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 1-(3,5-dichloro-4-pyridinyl)piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C11H11Cl2N3/c12-9-6-15-7-10(13)11(9)16-3-1-8(5-14)2-4-16/h6-8H,1-4H2 |
| InChIKey | ZVIYJBMVFXMWLA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |