C54H72F3NO14 — CID 45275465
5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;2,2,2-trifluoroacetic acid (PubChem CID 45275465) has the molecular formula C54H72F3NO14 and a molecular weight of 1016.16 g/mol. Its IUPAC name is 5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 45275465 |
| Molecular Formula | C54H72F3NO14 |
| Molecular Weight | 1016.16 g/mol |
| Exact Mass | 1015.49 |
| IUPAC Name | 5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C)cc(C(=O)OCCCCCNCCCCCOC(=O)c2cc(C)cc(C)c2)c1.O=C(O)C(F)(F)F.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C28H39NO4.C24H32O8.C2HF3O2/c1-21-15-22(2)18-25(17-21)27(30)32-13-9-5-7-11-29-12-8-6-10-14-33-28(31)26-19-23(3)16-24(4)20-26;1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;3-2(4,5)1(6)7/h15-20,29H,5-14H2,1-4H3;1-8H,9-20H2;(H,6,7) |
| InChIKey | QIEPORBLZPHBPZ-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 175.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.16 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|