C21H19Cl2NaO4 — CID 45275478
sodium (5S,8E,10E,12R)-15-(3,4-dichlorophenyl)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate (PubChem CID 45275478) has the molecular formula C21H19Cl2NaO4 and a molecular weight of 429.28 g/mol. Its IUPAC name is sodium (5S,8E,10E,12R)-15-(3,4-dichlorophenyl)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate.
| Compound Name | sodium (5S,8E,10E,12R)-15-(3,4-dichlorophenyl)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 45275478 |
| Molecular Formula | C21H19Cl2NaO4 |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | sodium (5S,8E,10E,12R)-15-(3,4-dichlorophenyl)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
| SMILES | O=C([O-])CCC[C@H](O)C#C/C=C/C=C/[C@H](O)CC#Cc1ccc(Cl)c(Cl)c1.[Na+] |
| InChI | InChI=1S/C21H20Cl2O4.Na/c22-19-14-13-16(15-20(19)23)7-5-10-17(24)8-3-1-2-4-9-18(25)11-6-12-21(26)27;/h1-3,8,13-15,17-18,24-25H,6,10-12H2,(H,26,27);/q;+1/p-1/b2-1+,8-3+;/t17-,18+;/m0./s1 |
| InChIKey | BLMYWQNAMQWDFL-YLPFTPGHSA-M |
| XLogP | -0.50 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|