C20H18FNaO4 — CID 45275480
sodium (4S,7E,9E,11R)-14-(4-fluorophenyl)-4,11-dihydroxytetradeca-7,9-dien-5,13-diynoate (PubChem CID 45275480) has the molecular formula C20H18FNaO4 and a molecular weight of 364.35 g/mol. Its IUPAC name is sodium (4S,7E,9E,11R)-14-(4-fluorophenyl)-4,11-dihydroxytetradeca-7,9-dien-5,13-diynoate.
| Compound Name | sodium (4S,7E,9E,11R)-14-(4-fluorophenyl)-4,11-dihydroxytetradeca-7,9-dien-5,13-diynoate |
|---|---|
| PubChem CID | 45275480 |
| Molecular Formula | C20H18FNaO4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | sodium (4S,7E,9E,11R)-14-(4-fluorophenyl)-4,11-dihydroxytetradeca-7,9-dien-5,13-diynoate |
| SMILES | O=C([O-])CC[C@H](O)C#C/C=C/C=C/[C@H](O)CC#Cc1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C20H19FO4.Na/c21-17-12-10-16(11-13-17)6-5-9-18(22)7-3-1-2-4-8-19(23)14-15-20(24)25;/h1-3,7,10-13,18-19,22-23H,9,14-15H2,(H,24,25);/q;+1/p-1/b2-1+,7-3+;/t18-,19+;/m0./s1 |
| InChIKey | HIEVOTBVZNCNOO-MJNMRHPESA-M |
| XLogP | -2.06 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|