About [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone
[4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone (PubChem CID 45275621) has the molecular formula C15H15N5O3S
and a molecular weight of 345.38 g/mol. Its IUPAC name is [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
| PubChem CID | 45275621 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(-c2nc(N)c3cc(C(=O)N4CCOCC4)sc3n2)no1 |
| InChI | InChI=1S/C15H15N5O3S/c1-8-6-10(19-23-8)13-17-12(16)9-7-11(24-14(9)18-13)15(21)20-2-4-22-5-3-20/h6-7H,2-5H2,1H3,(H2,16,17,18) |
| InChIKey | HAVIRUFOWDATPT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone?
The IUPAC name of [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone (CID 45275621) is [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone is Cc1cc(-c2nc(N)c3cc(C(=O)N4CCOCC4)sc3n2)no1.
What is the InChIKey of [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone?
The InChIKey is HAVIRUFOWDATPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5O3S/c1-8-6-10(19-23-8)13-17-12(16)9-7-11(24-14(9)18-13)15(21)20-2-4-22-5-3-20/h6-7H,2-5H2,1H3,(H2,16,17,18).
What are the key properties of [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone?
[4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone has a molecular weight of 345.38 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2-(5-methyl-1,2-oxazol-3-yl)thieno[2,3-d]pyrimidin-6-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 45275621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).