About 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine
2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45275818) has the molecular formula C18H16N4S2
and a molecular weight of 352.49 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 45275818 |
| Molecular Formula | C18H16N4S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1csc(-c2nc(N)c3cc(C(C)c4ccccc4)sc3n2)n1 |
| InChI | InChI=1S/C18H16N4S2/c1-10-9-23-18(20-10)16-21-15(19)13-8-14(24-17(13)22-16)11(2)12-6-4-3-5-7-12/h3-9,11H,1-2H3,(H2,19,21,22) |
| InChIKey | TZEFSFNRGUGGIZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine (CID 45275818) is 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine is Cc1csc(-c2nc(N)c3cc(C(C)c4ccccc4)sc3n2)n1.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is TZEFSFNRGUGGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4S2/c1-10-9-23-18(20-10)16-21-15(19)13-8-14(24-17(13)22-16)11(2)12-6-4-3-5-7-12/h3-9,11H,1-2H3,(H2,19,21,22).
What are the key properties of 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine?
2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 352.49 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-2-yl)-6-(1-phenylethyl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 45275818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).