About 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine
6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 45275821) has the molecular formula C16H12N4OS
and a molecular weight of 308.37 g/mol. Its IUPAC name is 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 45275821 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2cnco2)nc2sc(Cc3ccccc3)cc12 |
| InChI | InChI=1S/C16H12N4OS/c17-14-12-7-11(6-10-4-2-1-3-5-10)22-16(12)20-15(19-14)13-8-18-9-21-13/h1-5,7-9H,6H2,(H2,17,19,20) |
| InChIKey | GQQVMWJRFKUPHG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine (CID 45275821) is 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine is Nc1nc(-c2cnco2)nc2sc(Cc3ccccc3)cc12.
What is the InChIKey of 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is GQQVMWJRFKUPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4OS/c17-14-12-7-11(6-10-4-2-1-3-5-10)22-16(12)20-15(19-14)13-8-18-9-21-13/h1-5,7-9H,6H2,(H2,17,19,20).
What are the key properties of 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine?
6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 308.37 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-2-(1,3-oxazol-5-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 45275821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).