About 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one
5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one (PubChem CID 45275938) has the molecular formula C15H12N2OS
and a molecular weight of 268.34 g/mol. Its IUPAC name is 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one.
Molecular Properties
| Compound Name | 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one |
| PubChem CID | 45275938 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one |
| SMILES | Cc1ccc2c(c1)C1(Nc3ccccc3S1)C(=O)N2 |
| InChI | InChI=1S/C15H12N2OS/c1-9-6-7-11-10(8-9)15(14(18)16-11)17-12-4-2-3-5-13(12)19-15/h2-8,17H,1H3,(H,16,18) |
| InChIKey | RAEVGSIUDBGGKA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one?
The IUPAC name of 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one (CID 45275938) is 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one.
What is the SMILES notation for 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one?
The canonical SMILES for 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one is Cc1ccc2c(c1)C1(Nc3ccccc3S1)C(=O)N2.
What is the InChIKey of 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one?
The InChIKey is RAEVGSIUDBGGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2OS/c1-9-6-7-11-10(8-9)15(14(18)16-11)17-12-4-2-3-5-13(12)19-15/h2-8,17H,1H3,(H,16,18).
What are the key properties of 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one?
5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one has a molecular weight of 268.34 g/mol, XLogP of 3.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylspiro[1H-indole-3,2'-3H-1,3-benzothiazole]-2-one is sourced from PubChem (CID 45275938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).