C11H15NO2 — CID 45276018
(7aR,10aS)-1,3,4,7,7a,8,9,10-octahydrocyclopenta[i]indolizine-2,6-dione (PubChem CID 45276018) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (7aR,10aS)-1,3,4,7,7a,8,9,10-octahydrocyclopenta[i]indolizine-2,6-dione.
| Compound Name | (7aR,10aS)-1,3,4,7,7a,8,9,10-octahydrocyclopenta[i]indolizine-2,6-dione |
|---|---|
| PubChem CID | 45276018 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (7aR,10aS)-1,3,4,7,7a,8,9,10-octahydrocyclopenta[i]indolizine-2,6-dione |
| SMILES | O=C1CCN2C(=O)C[C@H]3CCC[C@]32C1 |
| InChI | InChI=1S/C11H15NO2/c13-9-3-5-12-10(14)6-8-2-1-4-11(8,12)7-9/h8H,1-7H2/t8-,11+/m1/s1 |
| InChIKey | FUWMDICPUGCKSD-KCJUWKMLSA-N |
| XLogP | 1.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |