C14H10FNO7S2 — CID 45276054
(2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)-(4-nitrophenyl)methanol (PubChem CID 45276054) has the molecular formula C14H10FNO7S2 and a molecular weight of 387.37 g/mol. Its IUPAC name is (2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)-(4-nitrophenyl)methanol.
| Compound Name | (2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)-(4-nitrophenyl)methanol |
|---|---|
| PubChem CID | 45276054 |
| Molecular Formula | C14H10FNO7S2 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | (2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)-(4-nitrophenyl)methanol |
| SMILES | O=[N+]([O-])c1ccc(C(O)C2(F)S(=O)(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C14H10FNO7S2/c15-14(13(17)9-5-7-10(8-6-9)16(18)19)24(20,21)11-3-1-2-4-12(11)25(14,22)23/h1-8,13,17H |
| InChIKey | AEZIAPCQTHAYRL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 131.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|