C21H26NO4PS2 — CID 45276446
(3E,5E)-1-(2-diethoxyphosphorylethyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one (PubChem CID 45276446) has the molecular formula C21H26NO4PS2 and a molecular weight of 451.55 g/mol. Its IUPAC name is (3E,5E)-1-(2-diethoxyphosphorylethyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one.
| Compound Name | (3E,5E)-1-(2-diethoxyphosphorylethyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 45276446 |
| Molecular Formula | C21H26NO4PS2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | (3E,5E)-1-(2-diethoxyphosphorylethyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one |
| SMILES | CCOP(=O)(CCN1C/C(=C\c2cccs2)C(=O)/C(=C/c2cccs2)C1)OCC |
| InChI | InChI=1S/C21H26NO4PS2/c1-3-25-27(24,26-4-2)10-9-22-15-17(13-19-7-5-11-28-19)21(23)18(16-22)14-20-8-6-12-29-20/h5-8,11-14H,3-4,9-10,15-16H2,1-2H3/b17-13+,18-14+ |
| InChIKey | KVBZTUNXFGFDFU-HBKJEHTGSA-N |
| XLogP | 5.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|