C22H28NO4PS2 — CID 45276447
(3E,5E)-1-(3-diethoxyphosphorylpropyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one (PubChem CID 45276447) has the molecular formula C22H28NO4PS2 and a molecular weight of 465.58 g/mol. Its IUPAC name is (3E,5E)-1-(3-diethoxyphosphorylpropyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one.
| Compound Name | (3E,5E)-1-(3-diethoxyphosphorylpropyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 45276447 |
| Molecular Formula | C22H28NO4PS2 |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (3E,5E)-1-(3-diethoxyphosphorylpropyl)-3,5-bis(thiophen-2-ylmethylidene)piperidin-4-one |
| SMILES | CCOP(=O)(CCCN1C/C(=C\c2cccs2)C(=O)/C(=C/c2cccs2)C1)OCC |
| InChI | InChI=1S/C22H28NO4PS2/c1-3-26-28(25,27-4-2)11-7-10-23-16-18(14-20-8-5-12-29-20)22(24)19(17-23)15-21-9-6-13-30-21/h5-6,8-9,12-15H,3-4,7,10-11,16-17H2,1-2H3/b18-14+,19-15+ |
| InChIKey | BUEAQDZYVQZOSI-JSAVKQRWSA-N |
| XLogP | 5.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|