C16H16ClN3O4S2 — CID 45276488
ethyl [5-(5-tert-butyl-2-oxo-1,3,4-oxadiazol-3-yl)-6-chloro-1,3-benzothiazol-2-yl]sulfanylformate (PubChem CID 45276488) has the molecular formula C16H16ClN3O4S2 and a molecular weight of 413.91 g/mol. Its IUPAC name is ethyl [5-(5-tert-butyl-2-oxo-1,3,4-oxadiazol-3-yl)-6-chloro-1,3-benzothiazol-2-yl]sulfanylformate.
| Compound Name | ethyl [5-(5-tert-butyl-2-oxo-1,3,4-oxadiazol-3-yl)-6-chloro-1,3-benzothiazol-2-yl]sulfanylformate |
|---|---|
| PubChem CID | 45276488 |
| Molecular Formula | C16H16ClN3O4S2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | ethyl [5-(5-tert-butyl-2-oxo-1,3,4-oxadiazol-3-yl)-6-chloro-1,3-benzothiazol-2-yl]sulfanylformate |
| SMILES | CCOC(=O)Sc1nc2cc(-n3nc(C(C)(C)C)oc3=O)c(Cl)cc2s1 |
| InChI | InChI=1S/C16H16ClN3O4S2/c1-5-23-15(22)26-13-18-9-7-10(8(17)6-11(9)25-13)20-14(21)24-12(19-20)16(2,3)4/h6-7H,5H2,1-4H3 |
| InChIKey | KKBLLOYWQIAELP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|