About 4-(1H-indol-3-yl)-1,3-oxazole
4-(1H-indol-3-yl)-1,3-oxazole (PubChem CID 45276627) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(1H-indol-3-yl)-1,3-oxazole |
| PubChem CID | 45276627 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 4-(1H-indol-3-yl)-1,3-oxazole |
| SMILES | c1ccc2c(-c3cocn3)c[nH]c2c1 |
| InChI | InChI=1S/C11H8N2O/c1-2-4-10-8(3-1)9(5-12-10)11-6-14-7-13-11/h1-7,12H |
| InChIKey | IWHWVOLWEGLICO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1H-indol-3-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-indol-3-yl)-1,3-oxazole?
The IUPAC name of 4-(1H-indol-3-yl)-1,3-oxazole (CID 45276627) is 4-(1H-indol-3-yl)-1,3-oxazole.
What is the SMILES notation for 4-(1H-indol-3-yl)-1,3-oxazole?
The canonical SMILES for 4-(1H-indol-3-yl)-1,3-oxazole is c1ccc2c(-c3cocn3)c[nH]c2c1.
What is the InChIKey of 4-(1H-indol-3-yl)-1,3-oxazole?
The InChIKey is IWHWVOLWEGLICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-2-4-10-8(3-1)9(5-12-10)11-6-14-7-13-11/h1-7,12H.
What are the key properties of 4-(1H-indol-3-yl)-1,3-oxazole?
4-(1H-indol-3-yl)-1,3-oxazole has a molecular weight of 184.20 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-indol-3-yl)-1,3-oxazole is sourced from PubChem (CID 45276627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).