C20H40O2Si2 — CID 45276649
[(3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]oxy-triethylsilane (PubChem CID 45276649) has the molecular formula C20H40O2Si2 and a molecular weight of 368.71 g/mol. Its IUPAC name is [(3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]oxy-triethylsilane.
| Compound Name | [(3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 45276649 |
| Molecular Formula | C20H40O2Si2 |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [(3aS,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=C[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]2C1 |
| InChI | InChI=1S/C20H40O2Si2/c1-9-24(10-2,11-3)22-19-14-16-12-18(13-17(16)15-19)21-23(7,8)20(4,5)6/h14,16-18H,9-13,15H2,1-8H3/t16-,17+,18-/m1/s1 |
| InChIKey | UEWHLHXLGYCEEJ-FGTMMUONSA-N |
| XLogP | 6.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|