C19H40O3Si2 — CID 45277018
tert-butyl-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-methyloxolan-3-yl]oxy-dimethylsilane (PubChem CID 45277018) has the molecular formula C19H40O3Si2 and a molecular weight of 372.70 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-methyloxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-methyloxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 45277018 |
| Molecular Formula | C19H40O3Si2 |
| Molecular Weight | 372.70 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | tert-butyl-[(2S,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-5-methyloxolan-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H]1O[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O3Si2/c1-13-15-17(22-24(11,12)19(6,7)8)16(14(2)20-15)21-23(9,10)18(3,4)5/h13-17H,1H2,2-12H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | AJZLFMOVVJAODT-YYIAUSFCSA-N |
| XLogP | 5.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|