About 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide
4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide (PubChem CID 45277090) has the molecular formula C23H31N3O
and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide.
Molecular Properties
| Compound Name | 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide |
| PubChem CID | 45277090 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O/c1-2-3-15-24-23(27)26-17-10-16-25(18-19-26)22(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-14,22H,2-3,10,15-19H2,1H3,(H,24,27) |
| InChIKey | FFHUYSBLLHFVAT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide?
The IUPAC name of 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide (CID 45277090) is 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide.
What is the SMILES notation for 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide?
The canonical SMILES for 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide is CCCCNC(=O)N1CCCN(C(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide?
The InChIKey is FFHUYSBLLHFVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31N3O/c1-2-3-15-24-23(27)26-17-10-16-25(18-19-26)22(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h4-9,11-14,22H,2-3,10,15-19H2,1H3,(H,24,27).
What are the key properties of 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide?
4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide has a molecular weight of 365.52 g/mol, XLogP of 4.29, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydryl-N-butyl-1,4-diazepane-1-carboxamide is sourced from PubChem (CID 45277090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).